CAS 129815-48-1
:S-Acetylthioglycolic Acid Pentafluorophenyl Ester
Description:
S-Acetylthioglycolic Acid Pentafluorophenyl Ester, with the CAS number 129815-48-1, is a chemical compound characterized by its ester functional group derived from thioglycolic acid. This compound features a pentafluorophenyl group, which enhances its reactivity and solubility in organic solvents due to the presence of multiple electronegative fluorine atoms. The acetyl group contributes to its stability and potential applications in organic synthesis. Typically, such esters are utilized in various chemical reactions, including acylation and as intermediates in the synthesis of more complex molecules. The presence of the thiol group in the original thioglycolic acid structure suggests potential applications in biochemistry and materials science, particularly in the formation of disulfide bonds or as a reducing agent. Additionally, the pentafluorophenyl moiety may impart unique electronic properties, making this compound of interest in medicinal chemistry and the development of pharmaceuticals. Overall, S-Acetylthioglycolic Acid Pentafluorophenyl Ester is a versatile compound with significant potential in various chemical applications.
Formula:C10H5F5O3S
InChI:InChI=1/C10H5F5O3S/c1-3(16)19-2-4(17)18-10-8(14)6(12)5(11)7(13)9(10)15/h2H2,1H3
SMILES:CC(=O)SCC(=O)Oc1c(c(c(c(c1F)F)F)F)F
Synonyms:- Pentafluorophenyl (Acetylthio)Acetate
- Pentafluorophenyl S-Acetylthioglycolate
- Sama-Opfp
- Pentafluorophenyl (Acetylthio)Acetate, Pentafluorophenyl S-Acetylthioglycolate
- Pentafluorophenyl (Acetylsulfanyl)Acetate
- S-ACETYLTHIOGLYCOLIC ACID PENTAFLUOROPHENYL ESTER
- S-Acetylthioglycolic acid pentafluorophenyl ester≥ 98% (HPLC)
- (Acetylthio)acetic acid pentafluorophenyl ester
- SAMA-OPfp Novabiochem
- Acetic acid, 2-(acetylthio)-, 2,3,4,5,6-pentafluorophenyl ester
- Perfluorophenyl 2-(acetylthio)acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
