CAS 1298175-45-7

Methyl 4-amino-4-oxepanecarboxylate

Description:

Methyl 4-amino-4-oxepanecarboxylate is a chemical compound characterized by its unique structure, which includes an oxepane ring—a seven-membered cyclic structure containing one oxygen atom. This compound features an amino group, which contributes to its potential as a building block in organic synthesis and pharmaceutical applications. The presence of the carboxylate group indicates that it can participate in various chemical reactions, such as esterification and amidation. Methyl 4-amino-4-oxepanecarboxylate is likely to exhibit moderate solubility in polar solvents due to its functional groups, while its cyclic structure may impart some degree of rigidity compared to linear compounds. The compound's reactivity can be influenced by the amino and carboxylate functionalities, making it a candidate for further derivatization. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, this compound's structural features suggest it may have applications in medicinal chemistry and materials science.

Formula: C₈H₁₅NO₃

InChI: InChI=1S/C8H15NO3/c1-11-7(10)8(9)3-2-5-12-6-4-8/h2-6,9H2,1H3

InChI key: InChIKey=NCXDCQCUKCCEBG-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1(N)CCCOCC1

Synonyms:

• 4-Oxepanecarboxylic acid, 4-amino-, methyl ester
• Methyl 4-amino-4-oxepanecarboxylate