CAS 129821-08-5
:3-amino-10H-acridine-9-thione
Description:
3-Amino-10H-acridine-9-thione is a chemical compound characterized by its acridine backbone, which is a polycyclic aromatic structure known for its fluorescent properties. The presence of an amino group (-NH2) at the 3-position and a thione group (C=S) at the 9-position contributes to its reactivity and potential biological activity. This compound may exhibit properties such as antimicrobial, antitumor, or antiviral activities, making it of interest in medicinal chemistry. Its structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its solubility and stability in different solvents. The thione functionality can participate in nucleophilic reactions, while the amino group can act as a site for further functionalization. Additionally, the compound's unique electronic properties may be leveraged in dye applications or as a fluorescent probe in biochemical assays. Overall, 3-amino-10H-acridine-9-thione is a versatile compound with potential applications in pharmaceuticals and materials science.
Formula:C13H10N2S
InChI:InChI=1/C13H10N2S/c14-8-5-6-10-12(7-8)15-11-4-2-1-3-9(11)13(10)16/h1-7H,14H2,(H,15,16)
SMILES:c1ccc2c(c1)c(=S)c1ccc(cc1[nH]2)N
Synonyms:- 3-aminoacridine-9(10H)-thione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
3-ATA
CAS:<p>3-ATA is a selective cyclin-dependent kinase 4 (Cdk4) inhibitor, attenuating kainic acid-induced apoptosis in neurons.</p>Formula:C13H10N2SColor and Shape:SolidMolecular weight:226.3
