CymitQuimica logo

CAS 129821-74-5

:

Phosphonic acid, (1,1-dimethylethyl)-, mono(1-methylethyl) ester

Description:
Phosphonic acid, (1,1-dimethylethyl)-, mono(1-methylethyl) ester, commonly referred to by its CAS number 129821-74-5, is an organophosphorus compound characterized by the presence of a phosphonic acid functional group. This compound features a phosphonate ester structure, which is typically associated with applications in agriculture as a herbicide or pesticide. The presence of the tert-butyl and isopropyl groups contributes to its hydrophobic properties, influencing its solubility and reactivity in various environments. Phosphonic acids and their esters are known for their ability to form stable complexes with metal ions, which can enhance their efficacy in biological systems. Additionally, this compound may exhibit moderate toxicity, necessitating careful handling and usage in accordance with safety guidelines. Its chemical stability and potential for bioactivity make it a subject of interest in both industrial and research applications, particularly in the development of agrochemicals and pharmaceuticals.
Formula:C7H17O3P
InChI:InChI=1S/C7H17O3P/c1-6(2)10-11(8,9)7(3,4)5/h6H,1-5H3,(H,8,9)
InChI key:InChIKey=HWDPKRZPOBEQIG-UHFFFAOYSA-N
SMILES:P(OC(C)C)(C(C)(C)C)(=O)O
Synonyms:
  • Phosphonic acid, (1,1-dimethylethyl)-, mono(1-methylethyl) ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.