CAS 129865-06-1: XLLG
Description:The chemical substance identified by the name "XLLG" and CAS number "129865-06-1" is known as a synthetic compound with specific applications in various fields, including pharmaceuticals and materials science. While detailed characteristics such as its molecular structure, physical properties, and reactivity may vary, substances of this nature typically exhibit unique functional groups that contribute to their chemical behavior. Common characteristics may include solubility in organic solvents, stability under standard conditions, and potential biological activity, depending on its intended use. Additionally, safety data sheets would provide information on toxicity, handling precautions, and environmental impact. For precise applications and characteristics, consulting specialized literature or databases is recommended, as this compound may have specific regulatory considerations or proprietary information associated with its use.
Formula:C51H86O43
InChI:InChI=1/C51H86O43/c52-1-13-22(61)25(64)33(72)45(85-13)93-41-20(59)11(56)5-79-50(41)82-8-17-39(91-47-35(74)27(66)24(63)16(87-47)7-81-44-32(71)19(58)10(55)4-78-44)30(69)37(76)49(89-17)92-40-18(88-48(36(75)29(40)68)90-38-15(3-54)84-43(77)31(70)28(38)67)9-83-51-42(21(60)12(57)6-80-51)94-46-34(73)26(65)23(62)14(2-53)86-46/h10-77H,1-9H2
- Synonyms:
- Nonasaccharide,Glc4Xyl3Gal2
- Xyloglucan Nonasaccharide
- Nonasaccharide

Nonasaccharide Glc4Xyl3Gal2
Ref: 3B-N0693
100mg | 1,235.00 € |

D-Glucose, O-β-D-galactopyranosyl-(1→2)-O-α-D-xylopyranosyl-(1→6)-O-[O-α-D-xylopyranosyl-(1→6)-β-D-glucopyranosyl-(1→4)]-O-β-D-glucopyranosyl-(1→4)-O-[O-β-D-galactopyranosyl-(1→2)-α-D-xylopyranosyl-(1→6)]-O-β-D-glucopyranosyl-(1→4)-
Ref: IN-DA000TRC
100mg | To inquire |

Xyloglucan nonasaccharide
Ref: 3D-OX45928
25mg | 683.00 € | ||
50mg | 1,100.00 € | ||
100mg | 1,952.00 € | ||
200mg | 3,523.00 € | ||
500mg | 8,068.00 € |