CAS 129865-06-1
:XLLG
Description:
The chemical substance identified by the name "XLLG" and CAS number "129865-06-1" is known as a synthetic compound with specific applications in various fields, including pharmaceuticals and materials science. While detailed characteristics such as its molecular structure, physical properties, and reactivity may vary, substances of this nature typically exhibit unique functional groups that contribute to their chemical behavior. Common characteristics may include solubility in organic solvents, stability under standard conditions, and potential biological activity, depending on its intended use. Additionally, safety data sheets would provide information on toxicity, handling precautions, and environmental impact. For precise applications and characteristics, consulting specialized literature or databases is recommended, as this compound may have specific regulatory considerations or proprietary information associated with its use.
Formula:C51H86O43
InChI:InChI=1/C51H86O43/c52-1-13-22(61)25(64)33(72)45(85-13)93-41-20(59)11(56)5-79-50(41)82-8-17-39(91-47-35(74)27(66)24(63)16(87-47)7-81-44-32(71)19(58)10(55)4-78-44)30(69)37(76)49(89-17)92-40-18(88-48(36(75)29(40)68)90-38-15(3-54)84-43(77)31(70)28(38)67)9-83-51-42(21(60)12(57)6-80-51)94-46-34(73)26(65)23(62)14(2-53)86-46/h10-77H,1-9H2
SMILES:C(C1C(C(C(C(O1)OC1C(C(COC1OCC1C(C(C(C(O1)OC1C(COC2C(C(C(CO2)O)O)OC2C(C(C(C(CO)O2)O)O)O)OC(C(C1O)O)OC1C(CO)OC(C(C1O)O)O)O)O)OC1C(C(C(C(COC2C(C(C(CO2)O)O)O)O1)O)O)O)O)O)O)O)O)O
Synonyms:- Nonasaccharide,Glc4Xyl3Gal2
- Xyloglucan Nonasaccharide
- Nonasaccharide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Nonasaccharide Glc4Xyl3Gal2
CAS:Formula:C51H86O43Purity:>75.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:1,387.21Nonasaccharide Glc4Xyl3Gal2
CAS:Formula:C51H86O43Purity:75.0%Color and Shape:SolidMolecular weight:1387.2027Xyloglucan nonasaccharide
CAS:<p>Xyloglucan is a non-cellulosic polysaccharide polymer that is important in plant cell walls. Xyloglucan nonasaccharide (XN) is a linear molecule with an average molecular weight of 10,000 Da and consists of xylose monomers. The XN molecule has a basic structure, which may be due to the presence of amino acid residues, although the exact function of these amino acids is not known. XN has been shown to inhibit colony-stimulating factor (CSF) production and induce CSF release in mouse bone marrow cells. This inhibition may be due to the binding of XN to the monoclonal antibody CD45R on the surface of mouse bone marrow cells.</p>Formula:C51H86O43Purity:Min. 95%Color and Shape:PowderMolecular weight:1,387.2 g/mol



