
CAS 129872-83-9
:2,4-Dichloro-5-(phenylmethyl)-5H-pyrrolo[3,2-d]pyrimidine
Description:
2,4-Dichloro-5-(phenylmethyl)-5H-pyrrolo[3,2-d]pyrimidine is a heterocyclic organic compound characterized by its complex bicyclic structure, which incorporates both pyrrole and pyrimidine rings. The presence of two chlorine atoms at the 2 and 4 positions contributes to its reactivity and potential biological activity. The phenylmethyl group at the 5 position enhances its lipophilicity, which may influence its interaction with biological targets. This compound is typically studied for its potential pharmacological properties, particularly in the context of medicinal chemistry, where modifications to the core structure can lead to compounds with desirable therapeutic effects. Its molecular structure suggests potential applications in drug development, particularly in targeting specific enzymes or receptors. Additionally, the presence of halogens often indicates a compound's potential for further chemical modifications, making it a versatile scaffold in synthetic organic chemistry. As with many such compounds, safety and handling precautions are essential due to the presence of chlorine, which can pose health risks.
Formula:C13H9Cl2N3
InChI:InChI=1S/C13H9Cl2N3/c14-12-11-10(16-13(15)17-12)6-7-18(11)8-9-4-2-1-3-5-9/h1-7H,8H2
InChI key:InChIKey=NFNHWZVKVVHLFG-UHFFFAOYSA-N
SMILES:C(N1C=2C(C=C1)=NC(Cl)=NC2Cl)C3=CC=CC=C3
Synonyms:- 2,4-Dichloro-5-benzyl-5H-Pyrrolo[3,2-d]pyrimidine
- 2,4-Dichloro-5-(phenylmethyl)-5H-pyrrolo[3,2-d]pyrimidine
- 5H-Pyrrolo[3,2-d]pyrimidine, 2,4-dichloro-5-(phenylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
