CymitQuimica logo

CAS 129872-85-1

:

2-Chloro-5-ethyl-3,5-dihydro-4H-pyrrolo[3,2-d]pyrimidin-4-one

Description:
2-Chloro-5-ethyl-3,5-dihydro-4H-pyrrolo[3,2-d]pyrimidin-4-one is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyrimidine moieties. The presence of a chlorine atom at the second position and an ethyl group at the fifth position contributes to its chemical reactivity and solubility properties. This compound typically exhibits moderate polarity due to the functional groups present, which can influence its interactions in biological systems. It may participate in various chemical reactions, including nucleophilic substitutions and cyclization processes, owing to the electron-withdrawing nature of the chlorine substituent. Additionally, the compound's structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its synthesis and characterization would involve standard organic chemistry techniques, including chromatography and spectroscopy, to confirm its identity and purity. Overall, 2-Chloro-5-ethyl-3,5-dihydro-4H-pyrrolo[3,2-d]pyrimidin-4-one represents a class of compounds with intriguing chemical properties and potential biological significance.
Formula:C8H8ClN3O
InChI:InChI=1S/C8H8ClN3O/c1-2-12-4-3-5-6(12)7(13)11-8(9)10-5/h3-4H,2H2,1H3,(H,10,11,13)
InChI key:InChIKey=DNRBPQVAJGNGEM-UHFFFAOYSA-N
SMILES:C(C)N1C2=C(C=C1)NC(Cl)=NC2=O
Synonyms:
  • 2-Chloro-5-ethyl-3H-pyrrolo[3,2-d]pyrimidin-4(5H)-one
  • 2-Chloro-5-ethyl-3,5-dihydro-4H-pyrrolo[3,2-d]pyrimidin-4-one
  • 4H-Pyrrolo[3,2-d]pyrimidin-4-one, 2-chloro-5-ethyl-3,5-dihydro-
  • 2-Chloro-5-ethyl-3H,4H,5H-pyrrolo[3,2-d]pyrimidin-4-one
  • 4H-Pyrrolo[3,2-d]pyrimidin-4-one, 2-chloro-5-ethyl-1,5-dihydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.