CAS 129872-86-2

2-Chloro-3,5-dihydro-5-(phenylmethyl)-4H-pyrrolo[3,2-d]pyrimidin-4-one

Description:

2-Chloro-3,5-dihydro-5-(phenylmethyl)-4H-pyrrolo[3,2-d]pyrimidin-4-one is a heterocyclic organic compound characterized by its complex bicyclic structure, which includes a pyrrolopyrimidine framework. This compound features a chlorine atom at the 2-position and a phenylmethyl group at the 5-position, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the chlorine atom can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The compound may also exhibit biological activity, which is of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure suggests potential interactions with biological targets, making it a subject of research in drug discovery. As with many heterocycles, the stability and reactivity of this compound can be influenced by factors such as pH, temperature, and the presence of other chemical species.

Formula: C₁₃H₁₀ClN₃O

InChI: InChI=1S/C13H10ClN3O/c14-13-15-10-6-7-17(11(10)12(18)16-13)8-9-4-2-1-3-5-9/h1-7H,8H2,(H,15,16,18)

InChI key: InChIKey=TXHDJDOGTWTZAZ-UHFFFAOYSA-N

SMILES: C(N1C2=C(C=C1)NC(Cl)=NC2=O)C3=CC=CC=C3

Synonyms:

• 2-Chloro-3,5-dihydro-5-(phenylmethyl)-4H-pyrrolo[3,2-d]pyrimidin-4-one
• 4H-Pyrrolo[3,2-d]pyrimidin-4-one, 2-chloro-3,5-dihydro-5-(phenylmethyl)-
• 4H-Pyrrolo[3,2-d]pyrimidin-4-one, 2-chloro-1,5-dihydro-5-(phenylmethyl)-