CAS 129888-62-6

1,1-Dimethylethyl 3-(acetylamino)-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl 3-(acetylamino)-1-piperidinecarboxylate, with the CAS number 129888-62-6, is a chemical compound characterized by its complex structure, which includes a piperidine ring and an acetylamino group. This compound typically appears as a white to off-white solid or crystalline substance. It is soluble in organic solvents, reflecting its moderate polarity due to the presence of both hydrophobic and hydrophilic functional groups. The presence of the acetylamino group suggests potential reactivity, particularly in nucleophilic substitution reactions, and may influence its biological activity. The compound's piperidine moiety is often associated with various pharmacological properties, making it of interest in medicinal chemistry. Additionally, its ester functionality may contribute to its stability and reactivity in different chemical environments. Overall, this compound's unique structural features position it as a candidate for further research in drug development and synthetic applications.

Formula: C₁₂H₂₂N₂O₃

InChI: InChI=1S/C12H22N2O3/c1-9(15)13-10-6-5-7-14(8-10)11(16)17-12(2,3)4/h10H,5-8H2,1-4H3,(H,13,15)

InChI key: InChIKey=IRYIEVNNJRRABT-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CC(NC(C)=O)CCC1

Synonyms:

• 1-Piperidinecarboxylic acid, 3-(acetylamino)-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 3-(acetylamino)-1-piperidinecarboxylate