CAS 129894-64-0

Benzenemethanol, α-(aminomethyl)-2,4-dichloro-, (R)-

Description:

Benzenemethanol, α-(aminomethyl)-2,4-dichloro-, (R)-, also known by its CAS number 129894-64-0, is a chiral organic compound characterized by the presence of a benzene ring substituted with a dichloromethyl group and an amino group. This compound features a hydroxymethyl group attached to the benzene, contributing to its classification as a benzenemethanol derivative. The presence of two chlorine atoms at the 2 and 4 positions of the benzene ring significantly influences its chemical reactivity and physical properties, such as solubility and boiling point. The (R)- designation indicates its specific stereochemistry, which can affect its biological activity and interactions with other molecules. This compound may be of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential applications in synthesis and as a building block for more complex molecules. Its properties, such as melting point, boiling point, and solubility, would typically be determined through experimental methods and can vary based on purity and environmental conditions.

Formula: C₈H₉Cl₂NO

InChI: InChI=1S/C8H9Cl2NO/c9-5-1-2-6(7(10)3-5)8(12)4-11/h1-3,8,12H,4,11H2/t8-/m0/s1

InChI key: InChIKey=WTTIEVRVCBIEQJ-QMMMGPOBSA-N

SMILES: [C@@H](CN)(O)C1=C(Cl)C=C(Cl)C=C1

Synonyms:

• Benzenemethanol, α-(aminomethyl)-2,4-dichloro-, (R)-
• (1R)-2-Amino-1-(2,4-dichlorophenyl)ethan-1-ol