
CAS 129917-29-9
:1,2,3,4,5,6-Cyclohexanehexathione
Description:
1,2,3,4,5,6-Cyclohexanehexathione, with the CAS number 129917-29-9, is a sulfur-containing organic compound characterized by a cyclohexane ring with six thiol (sulfhydryl) groups attached. This unique structure imparts distinct chemical properties, including high reactivity due to the presence of multiple sulfur atoms, which can participate in various chemical reactions, such as oxidation and coordination with metals. The compound is typically a solid at room temperature and may exhibit a characteristic odor associated with thiols. Its solubility can vary depending on the solvent, but it is generally more soluble in polar solvents. The presence of multiple thiol groups also suggests potential applications in biochemistry and materials science, particularly in the formation of polymers or as a ligand in coordination chemistry. However, due to the reactivity of thiols, handling precautions are necessary to avoid unwanted reactions or degradation. As with many sulfur compounds, it may also have implications in environmental chemistry and toxicology, necessitating careful study of its behavior and effects in various contexts.
Formula:C6S6
InChI:InChI=1S/C6S6/c7-1-2(8)4(10)6(12)5(11)3(1)9
InChI key:InChIKey=OZKIZIQFPZROOY-UHFFFAOYSA-N
SMILES:S=C1C(=S)C(=S)C(=S)C(=S)C1=S
Synonyms:- Cyclohexanehexathione
- 1,2,3,4,5,6-Cyclohexanehexathione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
