CymitQuimica logo

CAS 1299474-18-2

:

1-Bromo-2-(cyclopropylsulfonyl)benzene

Description:
1-Bromo-2-(cyclopropylsulfonyl)benzene is an organic compound characterized by the presence of a bromine atom and a cyclopropylsulfonyl group attached to a benzene ring. The bromine substituent typically enhances the compound's reactivity, making it useful in various chemical reactions, such as nucleophilic substitutions or coupling reactions. The cyclopropylsulfonyl group introduces unique steric and electronic properties, which can influence the compound's behavior in chemical processes. This compound is likely to be a solid at room temperature, exhibiting moderate solubility in organic solvents due to its aromatic nature. Its sulfonyl group may impart polar characteristics, affecting its interactions with other molecules. Additionally, the presence of the bromine atom can facilitate further functionalization, making it a valuable intermediate in synthetic organic chemistry. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 1-Bromo-2-(cyclopropylsulfonyl)benzene is a versatile compound with potential applications in pharmaceuticals and materials science.
Formula:C9H9BrO2S
InChI:InChI=1S/C9H9BrO2S/c10-8-3-1-2-4-9(8)13(11,12)7-5-6-7/h1-4,7H,5-6H2
InChI key:InChIKey=UMMWZYLTPUYOAG-UHFFFAOYSA-N
SMILES:S(=O)(=O)(C1=C(Br)C=CC=C1)C2CC2
Synonyms:
  • 1-Bromo-2-(cyclopropylsulfonyl)benzene
  • Benzene, 1-bromo-2-(cyclopropylsulfonyl)-
  • 1-Bromo-2-(cyclopropanesulfonyl)benzene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.