CymitQuimica logo

CAS 129960-45-8

:

2-(3,5-dichlorophenyl)propan-2-amine

Description:
2-(3,5-Dichlorophenyl)propan-2-amine, also known as a substituted phenethylamine, is a chemical compound characterized by its amine functional group and a dichlorophenyl substituent. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the 3,5-dichlorophenyl group contributes to its hydrophobic characteristics, potentially affecting its biological activity and interaction with receptors. It may also exhibit pharmacological properties, as many compounds in this class are known for their stimulant or psychoactive effects. The compound's molecular structure suggests it could participate in various chemical reactions, including alkylation and acylation, and it may serve as a precursor or intermediate in the synthesis of other organic compounds. Safety and handling precautions are essential, as with many amines, due to potential toxicity and reactivity. Overall, 2-(3,5-dichlorophenyl)propan-2-amine is of interest in both synthetic organic chemistry and pharmacology.
Formula:C9H11Cl2N
InChI:InChI=1S/C9H11Cl2N/c1-9(2,12)6-3-7(10)5-8(11)4-6/h3-5H,12H2,1-2H3
InChI key:AZEJGVWRTXUSHS-UHFFFAOYSA-N
SMILES:CC(C)(C1=CC(=CC(=C1)Cl)Cl)N
Found 4 products.