CAS 1299607-38-7

N-(5-Fluoro-4-formyl-3-iodo-2-pyridinyl)-2,2-dimethylpropanamide

Description:

N-(5-Fluoro-4-formyl-3-iodo-2-pyridinyl)-2,2-dimethylpropanamide is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a fluorine atom, an aldehyde group, and an iodine atom. The presence of the 2,2-dimethylpropanamide moiety contributes to its amide functional group, which is known for its stability and ability to form hydrogen bonds. This compound may exhibit specific biological activities due to its unique functional groups, making it of interest in medicinal chemistry and drug development. The fluorine and iodine substitutions can influence the compound's lipophilicity, reactivity, and interaction with biological targets. Additionally, the compound's molecular structure suggests potential applications in various fields, including pharmaceuticals and agrochemicals. As with many halogenated compounds, it is essential to consider its environmental impact and toxicity profile during research and application. Overall, this compound represents a significant area of study for its potential therapeutic uses and chemical properties.

Formula: C₁₁H₁₂FIN₂O₂

InChI: InChI=1S/C11H12FIN2O2/c1-11(2,3)10(17)15-9-8(13)6(5-16)7(12)4-14-9/h4-5H,1-3H3,(H,14,15,17)

InChI key: InChIKey=XCASGYXCQHXWKR-UHFFFAOYSA-N

SMILES: N(C(C(C)(C)C)=O)C1=C(I)C(C=O)=C(F)C=N1

Synonyms:

• Propanamide, N-(5-fluoro-4-formyl-3-iodo-2-pyridinyl)-2,2-dimethyl-
• N-(5-Fluoro-4-formyl-3-iodo-2-pyridinyl)-2,2-dimethylpropanamide