CymitQuimica logo

CAS 1299607-39-8

:

4-Chloro-1-(phenylsulfonyl)-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid

Description:
4-Chloro-1-(phenylsulfonyl)-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid is a complex organic compound characterized by its unique structural features, including a pyrrolo[2,3-b]pyridine core, a chloro substituent, and a trifluoromethyl group. The presence of the phenylsulfonyl moiety enhances its potential for various chemical interactions, making it a candidate for applications in medicinal chemistry and drug development. This compound is likely to exhibit significant biological activity due to its structural diversity, which may influence its solubility, stability, and reactivity. The carboxylic acid functional group contributes to its acidity and potential for forming salts or esters. Additionally, the trifluoromethyl group is known to enhance lipophilicity and metabolic stability, which can be advantageous in pharmaceutical applications. Overall, the characteristics of this compound suggest it may have interesting properties for further research, particularly in the context of developing new therapeutic agents.
Formula:C15H8ClF3N2O4S
InChI:InChI=1S/C15H8ClF3N2O4S/c16-12-9-6-11(14(22)23)21(13(9)20-7-10(12)15(17,18)19)26(24,25)8-4-2-1-3-5-8/h1-7H,(H,22,23)
InChI key:InChIKey=RPQKKSQKWREHLG-UHFFFAOYSA-N
SMILES:S(=O)(=O)(N1C=2C(C=C1C(O)=O)=C(Cl)C(C(F)(F)F)=CN2)C3=CC=CC=C3
Synonyms:
  • 1H-Pyrrolo[2,3-b]pyridine-2-carboxylic acid, 4-chloro-1-(phenylsulfonyl)-5-(trifluoromethyl)-
  • 4-Chloro-1-(phenylsulfonyl)-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.