CAS 1299607-40-1
:7-Bromo-2,3-dihydro-1,4-dioxino[2,3-b]pyridine-8-carboxaldehyde
Description:
7-Bromo-2,3-dihydro-1,4-dioxino[2,3-b]pyridine-8-carboxaldehyde is a heterocyclic compound characterized by its unique bicyclic structure that incorporates both a pyridine and a dioxin moiety. The presence of a bromine atom at the 7-position contributes to its reactivity and potential applications in organic synthesis. The aldehyde functional group at the 8-position is significant for its reactivity, allowing for various chemical transformations, such as condensation reactions. This compound may exhibit biological activity due to its structural features, making it of interest in medicinal chemistry. Its solubility and stability can vary depending on the solvent and conditions, which is crucial for its application in laboratory settings. Additionally, the compound's molecular structure suggests potential interactions with biological targets, warranting further investigation into its pharmacological properties. Overall, 7-Bromo-2,3-dihydro-1,4-dioxino[2,3-b]pyridine-8-carboxaldehyde is a compound of interest for researchers exploring new chemical entities with potential therapeutic applications.
Formula:C8H6BrNO3
InChI:InChI=1S/C8H6BrNO3/c9-6-3-10-8-7(5(6)4-11)12-1-2-13-8/h3-4H,1-2H2
InChI key:InChIKey=JJNDHPAJDPGMOV-UHFFFAOYSA-N
SMILES:C(=O)C1=C2C(=NC=C1Br)OCCO2
Synonyms:- 1,4-Dioxino[2,3-b]pyridine-8-carboxaldehyde, 7-bromo-2,3-dihydro-
- 7-Bromo-2,3-dihydro-1,4-dioxino[2,3-b]pyridine-8-carboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.