CAS 1299607-41-2

Benzeneacetamide, 2-(4-morpholinyl)-, hydrochloride (1:1)

Description:

Benzeneacetamide, 2-(4-morpholinyl)-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group and a morpholine ring, which contributes to its pharmacological properties. The presence of the benzene ring provides hydrophobic characteristics, while the morpholine moiety enhances solubility and interaction with biological targets. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, making it suitable for various applications, particularly in medicinal chemistry. This compound may exhibit biological activity, potentially acting as a pharmaceutical agent, although specific therapeutic uses would depend on further research and testing. Its molecular structure suggests potential interactions with neurotransmitter systems, which could be relevant in the development of treatments for neurological disorders. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Overall, Benzeneacetamide, 2-(4-morpholinyl)-, hydrochloride (1:1) represents a class of compounds that may hold significance in drug development and therapeutic applications.

Formula: C₁₂H₁₆N₂O₂·ClH

InChI: InChI=1S/C12H16N2O2.ClH/c13-12(15)9-10-3-1-2-4-11(10)14-5-7-16-8-6-14;/h1-4H,5-9H2,(H2,13,15);1H

InChI key: InChIKey=KAGOHFHDUKOYGN-UHFFFAOYSA-N

SMILES: C(C(N)=O)C1=C(C=CC=C1)N2CCOCC2.Cl

Synonyms:

• Benzeneacetamide, 2-(4-morpholinyl)-, hydrochloride (1:1)

2-(Morpholin-4'-yl)phenylacetamide hydrochloride

CAS: 1299607-41-2

2-(Morpholin-4'-yl)phenylacetamide hydrochloride

Purity: 95%

Molecular weight: 256.73g/mol

Ref: 54-OR1004746