CAS 1299607-43-4

5-Chloro-4-iodo-2,3-dimethoxypyridine

Description:

5-Chloro-4-iodo-2,3-dimethoxypyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of chlorine and iodine substituents at the 5 and 4 positions, respectively, introduces significant reactivity and influences its chemical properties. The dimethoxy groups at the 2 and 3 positions enhance the compound's solubility in organic solvents and may also affect its electronic properties, making it a potential candidate for various chemical reactions. This compound is typically used in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to participate in nucleophilic substitutions and coupling reactions. Its unique structure may also impart specific biological activities, making it of interest in medicinal chemistry. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 5-Chloro-4-iodo-2,3-dimethoxypyridine is a versatile compound with applications in research and industry.

Formula: C₇H₇ClINO₂

InChI: InChI=1S/C7H7ClINO2/c1-11-6-5(9)4(8)3-10-7(6)12-2/h3H,1-2H3

InChI key: InChIKey=HGMCZYDZUSTGCK-UHFFFAOYSA-N

SMILES: O(C)C1=C(OC)N=CC(Cl)=C1I

Synonyms:

• Pyridine, 5-chloro-4-iodo-2,3-dimethoxy-
• 5-Chloro-4-iodo-2,3-dimethoxypyridine