CymitQuimica logo

CAS 1299607-47-8

:

1-[7-Bromo-6-[3-[[(1,1-dimethylethyl)dimethylsilyl]oxy]propyl]-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-1-yl]-2,2-dimethyl-1-propanone

Description:
1-[7-Bromo-6-[3-[[(1,1-dimethylethyl)dimethylsilyl]oxy]propyl]-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-1-yl]-2,2-dimethyl-1-propanone, with CAS number 1299607-47-8, is a complex organic compound characterized by its unique structural features, including a pyrido[2,3-b][1,4]oxazine core, which contributes to its potential biological activity. The presence of a bromine atom and a dimethylsilyl group suggests that it may exhibit interesting reactivity and stability properties. The compound also contains a ketone functional group, which can participate in various chemical reactions, including nucleophilic additions. Its bulky tert-butyl and dimethyl groups may influence its solubility and steric hindrance, affecting its interactions with other molecules. Such compounds are often of interest in medicinal chemistry and materials science due to their potential applications in drug development and as intermediates in synthetic pathways. Further studies would be necessary to elucidate its specific properties, reactivity, and potential applications in various fields.
Formula:C21H35BrN2O3Si
InChI:InChI=1S/C21H35BrN2O3Si/c1-20(2,3)19(25)24-11-13-26-18-17(24)14-15(22)16(23-18)10-9-12-27-28(7,8)21(4,5)6/h14H,9-13H2,1-8H3
InChI key:InChIKey=ULEGZPIBYWCLAM-UHFFFAOYSA-N
SMILES:C(C(C)(C)C)(=O)N1C=2C(=NC(CCCO[Si](C(C)(C)C)(C)C)=C(Br)C2)OCC1
Synonyms:
  • 1-[7-Bromo-6-[3-[[(1,1-dimethylethyl)dimethylsilyl]oxy]propyl]-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-1-yl]-2,2-dimethyl-1-propanone
  • 1-Propanone, 1-[7-bromo-6-[3-[[(1,1-dimethylethyl)dimethylsilyl]oxy]propyl]-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-1-yl]-2,2-dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.