CymitQuimica logo

CAS 1299607-50-3

:

5-Bromo-2-[2-(1,1-dimethylethoxy)ethoxy]-3-methoxypyridine

Description:
5-Bromo-2-[2-(1,1-dimethylethoxy)ethoxy]-3-methoxypyridine is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a bromine atom and various ethoxy and methoxy groups. The presence of the bromine atom introduces a halogen functionality, which can influence the compound's reactivity and solubility. The ethoxy groups contribute to the compound's hydrophobic characteristics, while the methoxy group can enhance its electron-donating properties. This compound is likely to exhibit moderate polarity due to the combination of hydrophobic and polar functional groups. It may be used in various applications, including medicinal chemistry, where such substituted pyridines can serve as intermediates or active pharmaceutical ingredients. Additionally, the presence of bulky groups like 1,1-dimethylethoxy may affect its steric hindrance, influencing its interaction with biological targets. Overall, the compound's unique structure suggests potential utility in research and development within organic synthesis and drug discovery.
Formula:C12H18BrNO3
InChI:InChI=1S/C12H18BrNO3/c1-12(2,3)17-6-5-16-11-10(15-4)7-9(13)8-14-11/h7-8H,5-6H2,1-4H3
InChI key:InChIKey=MPSRRQWBBJHLDR-UHFFFAOYSA-N
SMILES:O(CCOC(C)(C)C)C1=C(OC)C=C(Br)C=N1
Synonyms:
  • 5-Bromo-2-[2-(1,1-dimethylethoxy)ethoxy]-3-methoxypyridine
  • Pyridine, 5-bromo-2-[2-(1,1-dimethylethoxy)ethoxy]-3-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.