CAS 1299607-57-0
:1,1-Dimethylethyl 5-iodo-1H-pyrazolo[3,4-b]pyridine-1-carboxylate
Description:
1,1-Dimethylethyl 5-iodo-1H-pyrazolo[3,4-b]pyridine-1-carboxylate is a chemical compound characterized by its unique structure, which includes a pyrazolo[3,4-b]pyridine core substituted with an iodine atom and an ester functional group. The presence of the 1,1-dimethylethyl group contributes to its steric bulk, potentially influencing its reactivity and interactions with biological targets. This compound may exhibit properties typical of heterocyclic compounds, such as potential biological activity, making it of interest in medicinal chemistry. The iodine substituent can enhance the compound's lipophilicity and may also play a role in its pharmacological properties. Additionally, the carboxylate group suggests that it could participate in various chemical reactions, including esterification and nucleophilic substitutions. Overall, the combination of these structural features may render this compound useful in research and development, particularly in the fields of pharmaceuticals and agrochemicals. However, specific applications and biological activities would require further investigation through experimental studies.
Formula:C11H12IN3O2
InChI:InChI=1S/C11H12IN3O2/c1-11(2,3)17-10(16)15-9-7(5-14-15)4-8(12)6-13-9/h4-6H,1-3H3
InChI key:InChIKey=OEWBCEOBCVBANN-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1C=2C(C=N1)=CC(I)=CN2
Synonyms:- 1H-Pyrazolo[3,4-b]pyridine-1-carboxylic acid, 5-iodo-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl 5-iodo-1H-pyrazolo[3,4-b]pyridine-1-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.