CymitQuimica logo

CAS 1299607-61-6

:

2,5-Dichloro-3-(dimethoxymethyl)pyridine

Description:
2,5-Dichloro-3-(dimethoxymethyl)pyridine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of two chlorine atoms at the 2 and 5 positions of the pyridine ring contributes to its reactivity and potential applications in various chemical reactions. The dimethoxymethyl group at the 3-position introduces additional functional properties, enhancing its solubility and reactivity. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its molecular structure suggests that it may exhibit specific biological activities, although detailed studies would be necessary to elucidate its pharmacological properties. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Overall, 2,5-Dichloro-3-(dimethoxymethyl)pyridine is a versatile compound with potential applications in various fields of chemistry.
Formula:C8H9Cl2NO2
InChI:InChI=1S/C8H9Cl2NO2/c1-12-8(13-2)6-3-5(9)4-11-7(6)10/h3-4,8H,1-2H3
InChI key:InChIKey=JWEKIYARKOGXPR-UHFFFAOYSA-N
SMILES:C(OC)(OC)C1=C(Cl)N=CC(Cl)=C1
Synonyms:
  • Pyridine, 2,5-dichloro-3-(dimethoxymethyl)-
  • 2,5-Dichloro-3-(dimethoxymethyl)pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.