CAS 1299607-64-9

7-Bromo-2,3-dihydro-1,4-dioxino[2,3-b]pyridine-8-carboxylic acid

Description:

7-Bromo-2,3-dihydro-1,4-dioxino[2,3-b]pyridine-8-carboxylic acid is a heterocyclic compound characterized by its unique bicyclic structure that incorporates both a pyridine and a dioxin moiety. The presence of a bromine atom at the 7-position contributes to its reactivity and potential applications in medicinal chemistry. This compound features a carboxylic acid functional group, which enhances its solubility in polar solvents and may influence its biological activity. The dihydro configuration indicates that the compound has a saturated ring system, which can affect its stability and reactivity compared to fully unsaturated analogs. Its molecular structure suggests potential interactions with biological targets, making it of interest in drug development. Additionally, the compound's specific stereochemistry and functional groups may play a crucial role in its pharmacological properties. Overall, 7-Bromo-2,3-dihydro-1,4-dioxino[2,3-b]pyridine-8-carboxylic acid represents a complex and potentially bioactive molecule within the realm of organic and medicinal chemistry.

Formula: C₈H₆BrNO₄

InChI: InChI=1S/C8H6BrNO4/c9-4-3-10-7-6(5(4)8(11)12)13-1-2-14-7/h3H,1-2H2,(H,11,12)

InChI key: InChIKey=OSPQXIXPUIFUPE-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2C(=NC=C1Br)OCCO2

Synonyms:

• 7-Bromo-2,3-dihydro-1,4-dioxino[2,3-b]pyridine-8-carboxylic acid
• 1,4-Dioxino[2,3-b]pyridine-8-carboxylic acid, 7-bromo-2,3-dihydro-