CymitQuimica logo

CAS 1299607-70-7

:

4-Isoxazolecarboxylic acid, 5-(5-bromo-2-pyridinyl)-3-methyl-

Description:
4-Isoxazolecarboxylic acid, 5-(5-bromo-2-pyridinyl)-3-methyl- is a chemical compound characterized by its isoxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of a bromine atom on the pyridine ring enhances its electrophilic properties, making it useful in various chemical reactions, including substitution and coupling reactions. The methyl group at the 3-position of the isoxazole adds to the compound's steric and electronic properties, influencing its solubility and reactivity. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its unique structural features suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. As with many heterocyclic compounds, its synthesis and characterization are crucial for understanding its properties and potential uses in various chemical and biological contexts.
Formula:C10H7BrN2O3
InChI:InChI=1S/C10H7BrN2O3/c1-5-8(10(14)15)9(16-13-5)7-3-2-6(11)4-12-7/h2-4H,1H3,(H,14,15)
InChI key:InChIKey=LJPTWNZFJNDXOB-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(ON=C1C)C2=CC=C(Br)C=N2
Synonyms:
  • 4-Isoxazolecarboxylic acid, 5-(5-bromo-2-pyridinyl)-3-methyl-
  • 5-(5-Bromopyridin-2-yl)-3-methylisoxazole-4-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.