CAS 1299607-74-1
:5-Chloro-2-(dimethoxymethyl)furo[2,3-b]pyridine
Description:
5-Chloro-2-(dimethoxymethyl)furo[2,3-b]pyridine is a heterocyclic organic compound characterized by its fused furo and pyridine rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the 5-position and dimethoxymethyl groups enhances its reactivity and solubility in various solvents. This compound typically exhibits moderate to high polarity due to the electronegative chlorine and methoxy groups, which can influence its interactions in biological systems and chemical reactions. It may also display interesting pharmacological properties, making it a candidate for research in medicinal chemistry. The structural features suggest potential applications in the development of agrochemicals or pharmaceuticals. As with many heterocycles, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices. Overall, 5-Chloro-2-(dimethoxymethyl)furo[2,3-b]pyridine represents a complex structure with potential utility in various chemical applications.
Formula:C10H10ClNO3
InChI:InChI=1S/C10H10ClNO3/c1-13-10(14-2)8-4-6-3-7(11)5-12-9(6)15-8/h3-5,10H,1-2H3
InChI key:InChIKey=UFVABXALQYXGSV-UHFFFAOYSA-N
SMILES:C(OC)(OC)C=1OC=2C(C1)=CC(Cl)=CN2
Synonyms:- 5-Chloro-2-(dimethoxymethyl)furo[2,3-b]pyridine
- Furo[2,3-b]pyridine, 5-chloro-2-(dimethoxymethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.