CAS 1299607-75-2

5-Bromo-3-iodo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid

Description:

5-Bromo-3-iodo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid is a complex organic compound characterized by its unique heterocyclic structure, which incorporates both bromine and iodine halogens. This compound features a pyrrolo[2,3-b]pyridine core, which is a bicyclic structure known for its biological activity and potential pharmaceutical applications. The presence of the phenylsulfonyl group enhances its solubility and reactivity, making it suitable for various chemical reactions. The carboxylic acid functional group contributes to its acidity and potential for forming salts or esters. This compound may exhibit interesting pharmacological properties, making it a candidate for drug development, particularly in the fields of oncology or neurology. Its molecular structure suggests potential interactions with biological targets, although specific biological activity would require empirical investigation. As with many halogenated compounds, it may also exhibit unique reactivity patterns in synthetic chemistry. Safety and handling precautions should be observed due to the presence of halogens and the potential for toxicity.

Formula: C₁₄H₈BrIN₂O₄S

InChI: InChI=1S/C14H8BrIN2O4S/c15-8-6-10-11(16)12(14(19)20)18(13(10)17-7-8)23(21,22)9-4-2-1-3-5-9/h1-7H,(H,19,20)

InChI key: InChIKey=FVKWOKUCNQOJDT-UHFFFAOYSA-N

SMILES: S(=O)(=O)(N1C=2C(C(I)=C1C(O)=O)=CC(Br)=CN2)C3=CC=CC=C3

Synonyms:

• 1H-Pyrrolo[2,3-b]pyridine-2-carboxylic acid, 5-bromo-3-iodo-1-(phenylsulfonyl)-
• 5-Bromo-3-iodo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid