CAS 1299607-78-5

N-[5-Fluoro-3-iodo-4-(trimethylsilyl)-2-pyridinyl]-2,2-dimethylpropanamide

Description:

N-[5-Fluoro-3-iodo-4-(trimethylsilyl)-2-pyridinyl]-2,2-dimethylpropanamide is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with fluorine and iodine atoms, as well as a trimethylsilyl group. The presence of these halogen substituents often influences the compound's reactivity and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The trimethylsilyl group enhances the compound's lipophilicity, which can affect its bioavailability and interaction with biological systems. Additionally, the amide functional group contributes to the compound's ability to form hydrogen bonds, potentially impacting its solubility and stability. This compound is likely to be of interest in research contexts, particularly in studies related to drug design and synthesis. Its unique combination of functional groups suggests potential utility in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it a valuable candidate for further investigation in organic synthesis and medicinal applications.

Formula: C₁₃H₂₀FIN₂OSi

InChI: InChI=1S/C13H20FIN2OSi/c1-13(2,3)12(18)17-11-9(15)10(19(4,5)6)8(14)7-16-11/h7H,1-6H3,(H,16,17,18)

InChI key: InChIKey=NNHKPEYROUUKOG-UHFFFAOYSA-N

SMILES: N(C(C(C)(C)C)=O)C1=C(I)C([Si](C)(C)C)=C(F)C=N1

Synonyms:

• Propanamide, N-[5-fluoro-3-iodo-4-(trimethylsilyl)-2-pyridinyl]-2,2-dimethyl-
• N-[5-Fluoro-3-iodo-4-(trimethylsilyl)-2-pyridinyl]-2,2-dimethylpropanamide