CAS 1299607-80-9
:4-Chloro-3-iodo-1-(phenylsulfonyl)-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine
Description:
4-Chloro-3-iodo-1-(phenylsulfonyl)-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine is a complex organic compound characterized by its unique structural features, which include a pyrrolopyridine core, halogen substituents, and a sulfonyl group. The presence of chlorine and iodine atoms introduces significant electronegativity and potential for reactivity, while the trifluoromethyl group enhances lipophilicity and may influence biological activity. The phenylsulfonyl moiety contributes to the compound's overall stability and solubility in organic solvents. This compound may exhibit interesting pharmacological properties, making it a candidate for research in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the presence of multiple functional groups allows for further derivatization, potentially leading to the development of novel compounds with enhanced efficacy or selectivity. As with many synthetic organic compounds, safety and handling precautions are essential due to the presence of halogens and sulfonyl groups, which may pose health risks.
Formula:C14H7ClF3IN2O2S
InChI:InChI=1S/C14H7ClF3IN2O2S/c15-12-9(14(16,17)18)6-20-13-11(12)10(19)7-21(13)24(22,23)8-4-2-1-3-5-8/h1-7H
InChI key:InChIKey=CXRLKGOHZHTWRI-UHFFFAOYSA-N
SMILES:S(=O)(=O)(N1C=2C(=C(Cl)C(C(F)(F)F)=CN2)C(I)=C1)C3=CC=CC=C3
Synonyms:- 1-(Benzenesulfonyl)-4-chloro-3-iodo-5-(trifluoromethyl)pyrrolo[2,3-b]pyridine
- 1H-Pyrrolo[2,3-b]pyridine, 4-chloro-3-iodo-1-(phenylsulfonyl)-5-(trifluoromethyl)-
- 4-Chloro-3-iodo-1-(phenylsulfonyl)-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.