CAS 129968-11-2: Benzenamine, 2-bromo-5-methoxy-, hydrochloride (1:1)
Description:Benzenamine, 2-bromo-5-methoxy-, hydrochloride (1:1), also known by its CAS number 129968-11-2, is an organic compound characterized by the presence of a bromine atom and a methoxy group attached to a benzene ring, along with an amine functional group. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and facilitates its handling in various applications. The presence of the methoxy group contributes to its electronic properties, potentially influencing its reactivity and interaction with other chemical species. As a substituted aniline, it may exhibit biological activity, making it of interest in pharmaceutical research. The compound's molecular structure allows for various potential applications in organic synthesis, particularly in the development of more complex molecules. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, this compound represents a valuable building block in organic chemistry and medicinal chemistry research.
Formula:C7H8BrNO·ClH
InChI:InChI=1S/C7H8BrNO.ClH/c1-10-5-2-3-6(8)7(9)4-5;/h2-4H,9H2,1H3;1H
InChI key:InChIKey=UTLMWQABYASJPQ-UHFFFAOYSA-N
SMILES:Cl.BrC1=CC=C(OC)C=C1N
- Synonyms:
- 2-Bromo-5-methoxyaniline hydrochloride
- Benzenamine,2-bromo-5-methoxy-, hydrochloride
- Benzenamine, 2-bromo-5-methoxy-, hydrochloride (1:1)
- 2-Bromo-5-methoxy-phenylamine HCL
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Benzenamine, 2-bromo-5-methoxy-, hydrochloride (1:1) REF: IN-DA000TTWCAS: 129968-11-2 | 95% | 28.00 €~165.00 € | Fri 07 Mar 25 |
![]() | 2-Bromo-5-methoxyanilinehydrochloride REF: 54-OR95317CAS: 129968-11-2 | 95+% | 226.00 €~694.00 € | Mon 10 Mar 25 |
![]() | 2-Bromo-5-methoxyaniline hydrochloride REF: 10-F048787CAS: 129968-11-2 | 95.0% | To inquire | Mon 17 Mar 25 |
![]() | 2-Bromo-5-methoxyphenylamine HCl REF: 3D-FB38505CAS: 129968-11-2 | Min. 95% | - - - | Discontinued product |

Benzenamine, 2-bromo-5-methoxy-, hydrochloride (1:1)
Ref: IN-DA000TTW
1g | 28.00 € | ||
5g | 57.00 € | ||
25g | 165.00 € |

2-Bromo-5-methoxyaniline hydrochloride
Ref: 10-F048787
5g | 38.00 € | ||
25g | 117.00 € | ||
100g | 414.00 € |

2-Bromo-5-methoxyphenylamine HCl
Ref: 3D-FB38505
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information |