CAS 129973-51-9
:β,β-Difluorobenzeneethanol
Description:
β,β-Difluorobenzeneethanol, with the CAS number 129973-51-9, is an organic compound characterized by the presence of a benzene ring substituted with two fluorine atoms and a hydroxyl group (-OH) attached to an ethyl chain. This compound exhibits properties typical of both aromatic and alcohol functionalities, which can influence its reactivity and solubility. The presence of fluorine atoms generally enhances the compound's lipophilicity and can affect its biological activity, making it of interest in medicinal chemistry and materials science. β,β-Difluorobenzeneethanol may participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding due to the hydroxyl group. Its physical properties, such as boiling point and melting point, are influenced by the molecular structure and the electronegative fluorine atoms, which can also impact its stability and reactivity under different conditions. Overall, this compound's unique structure makes it a subject of interest for further research in various chemical applications.
Formula:C8H8F2O
InChI:InChI=1S/C8H8F2O/c9-8(10,6-11)7-4-2-1-3-5-7/h1-5,11H,6H2
InChI key:InChIKey=XKGODUKBPIRBOF-UHFFFAOYSA-N
SMILES:C(CO)(F)(F)C1=CC=CC=C1
Synonyms:- 2,2-Difluoro-2-phenylethan-1-ol
- β,β-Difluorobenzeneethanol
- 2,2-Difluoro-2-phenylethanol
- 2-Phenyl-2,2-difluoroethanol
- Benzeneethanol, β,β-difluoro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzeneethanol, β,β-difluoro-
CAS:Formula:C8H8F2OPurity:95%Color and Shape:LiquidMolecular weight:158.14532,2-Difluoro-2-phenylethan-1-ol
CAS:2,2-Difluoro-2-phenylethan-1-olPurity:95%Molecular weight:158.15g/mol²,²-difluoro- benzeneethanol
CAS:Difluoroethanol is a chemical compound that has been studied for its potential use as an asthma drug. It is a β2-adrenergic receptor agonist, which means it stimulates the β2-adrenergic receptors in the lungs to cause bronchodilation. The compound is not currently approved by the FDA and it has not yet been determined whether or not it will be safe for human use. Difluoroethanol binds to a different site on the β2-adrenoceptor than other drugs, which may allow it to have fewer side effects, but this has yet to be confirmed.Formula:C8H8F2OPurity:Min. 95%Molecular weight:158.14 g/mol



