
CAS 129976-34-7
:1-Fluoro-2-iodododecane
Description:
1-Fluoro-2-iodododecane is an organic compound characterized by the presence of both fluorine and iodine substituents on a dodecane backbone, which consists of a straight-chain alkane with twelve carbon atoms. The molecular structure features a fluorine atom at the first carbon position and an iodine atom at the second carbon position, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. This compound is typically a colorless to pale yellow liquid, exhibiting moderate volatility and solubility in organic solvents. Its unique halogen substituents can influence its physical properties, such as boiling point and density, as well as its chemical behavior, making it a candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the presence of halogens may impart specific biological activities, which could be of interest in pharmaceutical research. Safety precautions should be observed when handling this compound due to the potential hazards associated with halogenated organic compounds.
Formula:C12H24FI
InChI:InChI=1S/C12H24FI/c1-2-3-4-5-6-7-8-9-10-12(14)11-13/h12H,2-11H2,1H3
InChI key:InChIKey=CWDXUWPDAXOLFA-UHFFFAOYSA-N
SMILES:C(CCC(CF)I)CCCCCCC
Synonyms:- 1-Fluoro-2-iodododecane
- Dodecane, 1-fluoro-2-iodo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
