CAS 129979-57-3
:argipressin acetate
Description:
Argipressin acetate, also known as vasopressin acetate, is a synthetic analog of the naturally occurring antidiuretic hormone vasopressin. It is primarily characterized by its role in regulating water retention in the body and influencing blood pressure. The acetate form enhances its stability and solubility, making it suitable for pharmaceutical applications. This peptide hormone consists of a chain of amino acids, and its structure allows it to bind to specific receptors in the kidneys and blood vessels, promoting water reabsorption and vasoconstriction. Argipressin acetate is often utilized in clinical settings to manage conditions such as diabetes insipidus and certain types of shock. Its pharmacological effects include increasing blood volume and reducing urine output, which can be critical in treating patients with severe dehydration or hemorrhagic states. As with any medication, it is essential to monitor for potential side effects, including water retention and electrolyte imbalances, during its use.
Formula:C48H69N15O14S2
InChI:InChI=1/C46H65N15O12S2.C2H4O2/c47-27-22-74-75-23-33(45(73)61-17-5-9-34(61)44(72)56-28(8-4-16-53-46(51)52)39(67)54-21-37(50)65)60-43(71)32(20-36(49)64)59-40(68)29(14-15-35(48)63)55-41(69)31(18-24-6-2-1-3-7-24)58-42(70)30(57-38(27)66)19-25-10-12-26(62)13-11-25;1-2(3)4/h1-3,6-7,10-13,27-34,62H,4-5,8-9,14-23,47H2,(H2,48,63)(H2,49,64)(H2,50,65)(H,54,67)(H,55,69)(H,56,72)(H,57,66)(H,58,70)(H,59,68)(H,60,71)(H4,51,52,53);1H3,(H,3,4)/t27-,28-,29-,30-,31-,32-,33-,34-;/m0./s1
SMILES:c1ccc(cc1)C[C@H]1C(=N[C@@H](CCC(=N)O)C(=N[C@@H](CC(=N)O)C(=N[C@@H](CSSC[C@@H](C(=N[C@@H](Cc2ccc(cc2)O)C(=N1)O)O)N)C(=O)N1CCC[C@H]1C(=N[C@@H](CCCNC(=N)N)C(=NCC(=N)O)O)O)O)O)O.CC(=O)O
Synonyms:- Argipressine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
[Arg8]Vasopressin TFA
CAS:Formula:C48H66F3N15O14S2Purity:98%Color and Shape:SolidMolecular weight:1198.2549[Arg 8]-Vasopressin Acetate
CAS:Formula:C46H65N15O12S2·xC2H4O2Purity:>98.0%(HPLC)Color and Shape:White to Light yellow powder to crystalVasopressin acetate
CAS:Controlled ProductVasopressin acetate is a synthetic analog of the natural hormone vasopressin, which is derived from peptide synthesis. This product acts as an antidiuretic hormone, primarily targeting kidney receptors to promote water reabsorption and constrict blood vessels. Its mode of action involves binding to V1 and V2 receptors, leading to increased water retention and vasoconstriction.Formula:C46H65N15O12S2•(C2H4O2)xPurity:Min. 98 Area-%Color and Shape:White PowderMolecular weight:1198.26



