CAS 129999-62-8: [1-(2-aminoethyl)-4-piperidinyl]methanol
Description:[1-(2-aminoethyl)-4-piperidinyl]methanol, with the CAS number 129999-62-8, is a chemical compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features an aminoethyl side chain, contributing to its potential as a biological active agent. The presence of a hydroxymethyl group (-CH2OH) indicates that it can participate in hydrogen bonding, which may enhance its solubility in polar solvents and influence its reactivity. The amino group suggests that it may exhibit basic properties, allowing it to interact with acids and participate in various chemical reactions, including nucleophilic substitutions. This compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with biological targets. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied.
Formula:C8H18N2O
InChI:InChI=1/C8H18N2O/c9-3-6-10-4-1-8(7-11)2-5-10/h8,11H,1-7,9H2
- Synonyms:
- [1-(2-Aminoethyl)Piperidin-4-Yl]Methanol
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 4-Piperidinemethanol, 1-(2-aminoethyl)- REF: IN-DA000TU9CAS: 129999-62-8 | 97% | To inquire | Mon 10 Mar 25 |
![]() | [1-(2-Amino-ethyl)-piperidin-4-yl]-methanol REF: 10-F082632CAS: 129999-62-8 | 95.0% | To inquire | Thu 20 Mar 25 |
![]() | [1-(2-Aminoethyl)piperidin-4-yl]methanol REF: 3D-FA123778CAS: 129999-62-8 | Min. 95% | - - - | Discontinued product |

4-Piperidinemethanol, 1-(2-aminoethyl)-
Ref: IN-DA000TU9
1g | 486.00 € | ||
5g | To inquire |

[1-(2-Amino-ethyl)-piperidin-4-yl]-methanol
Ref: 10-F082632
1g | To inquire | ||
5g | To inquire | ||
250mg | To inquire |

[1-(2-Aminoethyl)piperidin-4-yl]methanol
Ref: 3D-FA123778
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |