CymitQuimica logo

CAS 130-34-7

:

2-(4-Nitrophenyl)-2H-naphtho[1,2-d]triazole-6,8-disulfonic acid

Description:
2-(4-Nitrophenyl)-2H-naphtho[1,2-d]triazole-6,8-disulfonic acid, with the CAS number 130-34-7, is a synthetic organic compound known for its complex structure and functional properties. This substance features a naphtho[1,2-d]triazole core, which is a bicyclic compound that incorporates both nitrogen and carbon atoms, contributing to its unique chemical behavior. The presence of sulfonic acid groups enhances its solubility in water, making it useful in various applications, particularly in dye chemistry and as a pH indicator. The nitrophenyl group introduces electron-withdrawing characteristics, which can influence the compound's reactivity and stability. Additionally, this compound may exhibit fluorescence properties, making it valuable in analytical chemistry and biological studies. Its potential applications extend to fields such as materials science and environmental monitoring, where its ability to interact with other chemical species can be exploited. Overall, 2-(4-Nitrophenyl)-2H-naphtho[1,2-d]triazole-6,8-disulfonic acid is a versatile compound with significant implications in both research and industrial contexts.
Formula:C16H10N4O8S2
InChI:InChI=1S/C16H10N4O8S2/c21-20(22)10-3-1-9(2-4-10)19-17-14-6-5-12-13(16(14)18-19)7-11(29(23,24)25)8-15(12)30(26,27)28/h1-8H,(H,23,24,25)(H,26,27,28)
InChI key:InChIKey=YHIPGHKFOXNVKS-UHFFFAOYSA-N
SMILES:S(=O)(=O)(O)C1=C2C(C=3C(=NN(N3)C4=CC=C(N(=O)=O)C=C4)C=C2)=CC(S(=O)(=O)O)=C1
Synonyms:
  • 2-(p-Nitrophenyl)-2H-naphtho[1,2-d]triazole-6,8-disulphonic acid
  • 2H-Naphtho[1,2-d]triazole-6,8-disulfonic acid, 2-(4-nitrophenyl)-
  • 2-(4-Nitrophenyl)-2H-naphtho[1,2-d]triazole-6,8-disulfonic acid
  • 2H-Naphtho[1,2-d]triazole-6,8-disulfonic acid, 2-(p-nitrophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.