
CAS 130-50-7
:2′-GMP
Description:
2′-GMP, or 2′-guanosine monophosphate, is a nucleotide that plays a crucial role in various biological processes, particularly in cellular signaling and metabolism. It is a derivative of guanosine and consists of a guanine base, a ribose sugar, and a phosphate group attached to the 2' position of the sugar. This structural configuration allows 2′-GMP to participate in the synthesis of RNA and act as a signaling molecule in pathways involving cyclic GMP (cGMP), which is important for regulating various physiological functions, including vasodilation and neurotransmission. The compound is soluble in water and exhibits a tendency to form hydrogen bonds due to its polar nature, which contributes to its biological activity. Additionally, 2′-GMP can be phosphorylated to form 2′,3′-cyclic GMP, further expanding its role in cellular signaling. Its CAS number, 130-50-7, is a unique identifier that facilitates the identification and study of this compound in scientific literature and databases.
Formula:C10H14N5O8P
InChI:InChI=1S/C10H14N5O8P/c11-10-13-7-4(8(18)14-10)12-2-15(7)9-6(23-24(19,20)21)5(17)3(1-16)22-9/h2-3,5-6,9,16-17H,1H2,(H2,19,20,21)(H3,11,13,14,18)/t3-,5-,6-,9-/m1/s1
InChI key:InChIKey=WTIFIAZWCCBCGE-UUOKFMHZSA-N
SMILES:O(P(=O)(O)O)[C@H]1[C@@H](O[C@H](CO)[C@H]1O)N2C3=C(N=C2)C(=O)N=C(N)N3
Synonyms:- Guanosine 2′-monophosphate
- Guanosine 2′-(dihydrogen phosphate)
- 2′-GMP
- 2′-Guanylic acid
- Guanosine 2′-phosphate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
