
CAS 130-59-6
:8-Nitronaphth[1,2-d][1,2,3]oxadiazole-5-sulfonic acid
Description:
8-Nitronaphth[1,2-d][1,2,3]oxadiazole-5-sulfonic acid, with the CAS number 130-59-6, is a chemical compound characterized by its complex structure, which includes a naphthalene ring fused with an oxadiazole moiety and a nitro group. This compound is typically a solid at room temperature and exhibits a yellow to orange color due to the presence of the nitro group, which can also influence its electronic properties. It is known for its sulfonic acid functional group, which imparts acidic characteristics and enhances its solubility in polar solvents. The presence of the nitro group contributes to its potential as a chromophore, making it useful in various applications, including dye chemistry and as a fluorescent probe. Additionally, this compound may exhibit biological activity, making it of interest in medicinal chemistry. Its stability and reactivity can vary depending on environmental conditions, such as pH and temperature, which are important considerations in its handling and application.
Formula:C10H5N3O6S
InChI:InChI=1S/C10H5N3O6S/c14-13(15)5-1-2-6-7(3-5)10-8(19-12-11-10)4-9(6)20(16,17)18/h1-4H,(H,16,17,18)
InChI key:InChIKey=SQHJNWIFJGDCQA-UHFFFAOYSA-N
SMILES:S(=O)(=O)(O)C=1C=2C(C3=C(C1)ON=N3)=CC(N(=O)=O)=CC2
Synonyms:- Naphth[1,2-d][1,2,3]oxadiazole-5-sulfonic acid, 8-nitro-
- 8-Nitronaphth[1,2-d][1,2,3]oxadiazole-5-sulfonic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Naphth[1,2-d][1,2,3]oxadiazole-5-sulfonic acid, 8-nitro-
CAS:Formula:C10H5N3O6SMolecular weight:295.2282
