CAS 130-73-4
:Methestrol
Description:
Methestrol, with the CAS number 130-73-4, is a synthetic estrogen that belongs to the class of compounds known as stilbenes. It is characterized by its structural similarity to natural estrogens, which allows it to bind to estrogen receptors in the body, thereby exerting estrogenic effects. Methestrol is typically used in hormone replacement therapy and may also have applications in treating certain hormone-sensitive conditions. The compound is known for its relatively high potency compared to some other synthetic estrogens. In terms of physical properties, Methestrol is generally a white to off-white crystalline powder, and it is soluble in organic solvents but has limited solubility in water. Its stability and efficacy can be influenced by factors such as pH and temperature. As with many synthetic hormones, the use of Methestrol may be associated with potential side effects and risks, necessitating careful consideration and monitoring in clinical applications.
Formula:C20H26O2
InChI:InChI=1S/C20H26O2/c1-5-17(15-7-9-19(21)13(3)11-15)18(6-2)16-8-10-20(22)14(4)12-16/h7-12,17-18,21-22H,5-6H2,1-4H3
InChI key:InChIKey=PYWBJEDBESDHNP-UHFFFAOYSA-N
SMILES:C(C(CC)C1=CC(C)=C(O)C=C1)(CC)C2=CC(C)=C(O)C=C2
Synonyms:- o-Cresol, 4,4′-(1,2-diethylethylene)di-
- 4,4′-(1,2-Diethylethylene)di-o-cresol
- 3,4-Bis(3-methyl-4-hydroxyphenyl)hexane
- Phenol, 4,4′-(1,2-diethyl-1,2-ethanediyl)bis[2-methyl-
- 4,4′-(1,2-Diethyl-1,2-ethanediyl)bis[2-methylphenol]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
