CAS 130-84-7
:Dimethyl diacetoxyfumarate
Description:
Dimethyl diacetoxyfumarate, with the CAS number 130-84-7, is an organic compound characterized by its structure, which features a fumarate backbone with two acetoxy groups and two methyl groups attached. This compound is typically a colorless to pale yellow liquid and is known for its reactivity, particularly in esterification and polymerization reactions. It is soluble in organic solvents such as ethanol and acetone but has limited solubility in water due to its hydrophobic methyl groups. Dimethyl diacetoxyfumarate is often utilized in organic synthesis and as a reagent in various chemical reactions, including those involving the formation of polymers and other complex organic molecules. Its functional groups contribute to its ability to participate in nucleophilic addition reactions, making it valuable in the development of pharmaceuticals and agrochemicals. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested, and appropriate protective equipment should be used.
Formula:C10H12O8
InChI:InChI=1/C10H12O8/c1-5(11)17-7(9(13)15-3)8(10(14)16-4)18-6(2)12/h1-4H3/b8-7-
SMILES:CC(=O)O/C(=C(/C(=O)OC)\OC(=O)C)/C(=O)OC
Synonyms:- (E)-2,3-Bis(acetyloxy)-2-butenedioic acid dimethyl ester
- dimethyl (2Z)-2,3-bis(acetyloxy)but-2-enedioate
- Dimethyl (Z)-2,3-Diacetyloxybut-2-Enedioate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,4-Dimethyl (2E)-2,3-bis(acetyloxy)but-2-enedioate
CAS:Formula:C10H12O8Color and Shape:SolidMolecular weight:260.1975
