CAS 130-85-8: Pamoic acid
Description:Pamoic acid, also known as embonic acid, is an organic compound characterized by its structure as a dicarboxylic acid. It features a naphthalene backbone with two carboxylic acid functional groups, which contributes to its acidic properties. The compound is typically a white to off-white crystalline powder and is sparingly soluble in water, but more soluble in organic solvents such as ethanol and acetone. Pamoic acid is primarily used in the pharmaceutical industry, particularly as a component in the formulation of certain medications, including those for treating parasitic infections. Its ability to form salts and complexes with various drugs enhances their solubility and bioavailability. Additionally, pamoic acid has been studied for its potential applications in drug delivery systems and as a stabilizing agent in various formulations. Due to its chemical structure, it can also exhibit properties such as antimicrobial activity. As with many chemical substances, handling pamoic acid requires appropriate safety measures to mitigate any potential health risks.
Formula:C23H16O6
InChI:InChI=1S/C23H16O6/c24-20-16(14-7-3-1-5-12(14)9-18(20)22(26)27)11-17-15-8-4-2-6-13(15)10-19(21(17)25)23(28)29/h1-10,24-25H,11H2,(H,26,27)(H,28,29)
InChI key:InChIKey=WLJNZVDCPSBLRP-UHFFFAOYSA-N
SMILES:O=C(O)C1=CC=2C=CC=CC2C(=C1O)CC3=C(O)C(=CC=4C=CC=CC43)C(=O)O
- Synonyms:
- 2,2-Dihydroxy-1,1-Dinaphthylmethane-3,3-Dicarboxylic Acid
- 2-Naphthalenecarboxylic acid, 4,4′-methylenebis[3-hydroxy-
- 2-Naphthoic acid, 4,4′-methylenebis[3-hydroxy-
- 3,3-Dihydroxy-4,4-Methylenedi(2-Naphthoic Acid)
- 4,4'-Methanediylbis(3-Hydroxynaphthalene-2-Carboxylate)
- 4,4'-Methanediylbis(3-Hydroxynaphthalene-2-Carboxylic Acid)
- 4,4-Methylenebis[3-hydroxy-2-naphthalenecarboxylic acid]
- 4,4′-Methylenebis[3-hydroxy-2-naphthoic acid]
- 4-[(3-Carboxy-2-hydroxynaphthalen-1-yl)methyl]-3-hydroxynaphthalene-2-carboxylic acid
- Bis(2-hydroxy-3-carboxy-1-naphthyl)methane
- See more synonyms
- Dilithium 4,4'-Methanediylbis(3-Hydroxynaphthalene-2-Carboxylate)
- Embonic acid
- Embonic acid~4,4-Methylenebis(3-hydroxy-2-naphthoic acid)
- Kg 122
- NSC 30188
- NSC 40132
