CAS 1300-73-8
:Xylidine
Description:
Xylidine refers to a group of chemical compounds that are derivatives of xylene, specifically containing an amino group (-NH2) attached to the aromatic ring. The compound associated with the CAS number 1300-73-8 is a mixture of isomers of xylidine, primarily used in the production of dyes, pigments, and as an intermediate in organic synthesis. Xylidine is typically a colorless to yellowish liquid with a characteristic aromatic odor. It is soluble in organic solvents but has limited solubility in water. The substance is flammable and poses health risks, including skin and respiratory irritation, and potential long-term effects with prolonged exposure. Proper handling and safety measures are essential when working with xylidine, including the use of personal protective equipment and adequate ventilation. Additionally, xylidine can undergo various chemical reactions, such as nitration and sulfonation, making it a versatile compound in chemical manufacturing.
Formula:C8H11N
InChI:InChI=1/C8H11N/c1-6-3-4-8(9)7(2)5-6/h3-5H,9H2,1-2H3
SMILES:Cc1ccc(c(C)c1)N
Synonyms:- Aminodimethylbenzene
- Benzenamine, ar,ar-dimethyl-
- DMA mixture
- Dimethylaniline
- Dimethylaniline mixture
- Mix Xylidine
- Xylidine
- Xylidines
- ar,ar-Dimethylaniline
- ar,ar-Dimethylbenzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.