CAS 130000-78-1
:(4-methoxy-3,5-dimethylpyridin-2-yl)methanamine
Description:
(4-Methoxy-3,5-dimethylpyridin-2-yl)methanamine is an organic compound characterized by its pyridine ring structure, which is substituted with a methoxy group and two methyl groups. The presence of the methanamine functional group indicates that it contains an amine, which contributes to its basicity and potential reactivity. This compound is likely to be a pale yellow to brown solid or liquid, depending on its purity and specific conditions. Its molecular structure suggests it may exhibit polar characteristics due to the methoxy and amine groups, influencing its solubility in various solvents. The compound may also participate in hydrogen bonding, affecting its boiling and melting points. Additionally, due to the presence of the pyridine ring, it may exhibit aromatic properties, contributing to its stability and reactivity in organic synthesis. Applications could range from pharmaceuticals to agrochemicals, depending on its biological activity and interaction with other chemical entities. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C9H14N2O
InChI:InChI=1/C9H14N2O/c1-6-5-11-8(4-10)7(2)9(6)12-3/h5H,4,10H2,1-3H3
SMILES:Cc1cnc(CN)c(C)c1OC
Synonyms:- 2-Pyridinemethanamine, 4-Methoxy-3,5-Dimethyl-
- 1-(4-Methoxy-3,5-Dimethylpyridin-2-Yl)Methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
