CAS 13001-15-5
:9-Octadecenoic acid (9Z)-, nickel(2+) salt (2:1)
Description:
9-Octadecenoic acid (9Z)-, nickel(2+) salt (2:1), commonly known as nickel oleate, is a coordination compound formed from nickel ions and oleic acid, a monounsaturated fatty acid. This substance typically appears as a greenish or yellowish solid and is soluble in organic solvents such as ethanol and chloroform, but less soluble in water. Nickel oleate is characterized by its ability to form stable complexes, which can influence its reactivity and applications. It is often used as a catalyst in organic synthesis, particularly in reactions involving olefins, and can serve as a surfactant or emulsifying agent in various formulations. The presence of nickel ions imparts unique properties, including potential catalytic activity and the ability to facilitate certain chemical transformations. Additionally, nickel oleate may exhibit biological activity, making it of interest in fields such as biochemistry and materials science. However, handling should be done with care due to the potential toxicity of nickel compounds.
Formula:C18H34O2Ni
InChI:InChI=1S/C18H34O2.Ni/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;/h9-10H,2-8,11-17H2,1H3,(H,19,20);/b10-9-;
InChI key:InChIKey=PXFAWKNRNHXITF-KVVVOXFISA-N
SMILES:C(C/C=C\CCCCCCCC)CCCCCC(O)=O.[Ni]
Synonyms:- 9-Octadecenoic acid (9Z)-, nickel(2+) salt
- Nickel oleate
- 9-Octadecenoic acid (9Z)-, nickel(2+) salt (2:1)
- 9-Octadecenoic acid (Z)-, nickel(2+) salt
- Oleic acid, nickel(2+) salt
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
