
CAS 1300118-55-1
:Pyrazino[2,3-b]pyrazin-2(1H)-one, 1-ethyl-3,4-dihydro-7-[2-methyl-6-(1H-1,2,4-triazol-5-yl)-3-pyridinyl]-, hydrochloride (1:?)
Description:
Pyrazino[2,3-b]pyrazin-2(1H)-one, 1-ethyl-3,4-dihydro-7-[2-methyl-6-(1H-1,2,4-triazol-5-yl)-3-pyridinyl]-, hydrochloride (CAS 1300118-55-1) is a synthetic organic compound characterized by its complex heterocyclic structure, which includes pyrazine and triazole moieties. This compound typically exhibits properties such as solubility in polar solvents, which is common for hydrochloride salts, and may demonstrate biological activity, potentially as an antimicrobial or antifungal agent, due to the presence of the triazole and pyridine groups. Its molecular structure suggests it may interact with biological targets, making it of interest in pharmaceutical research. The compound's stability, reactivity, and specific interactions would depend on its functional groups and the overall electronic environment. As with many heterocycles, it may also exhibit unique spectroscopic characteristics, aiding in its identification and characterization through techniques such as NMR and mass spectrometry. Further studies would be necessary to fully elucidate its pharmacological properties and potential applications.
Formula:C16H16N8O·xClH
InChI:InChI=1S/C16H16N8O.ClH/c1-3-24-13(25)7-18-15-16(24)22-12(6-17-15)10-4-5-11(21-9(10)2)14-19-8-20-23-14;/h4-6,8H,3,7H2,1-2H3,(H,17,18)(H,19,20,23);1H
InChI key:InChIKey=RDIPJCOMBMBHJF-UHFFFAOYSA-N
SMILES:C(C)N1C=2C(NC=C(N2)C3=C(C)N=C(C=C3)C=4NC=NN4)=NCC1=O.Cl
Synonyms:- Pyrazino[2,3-b]pyrazin-2(1H)-one, 1-ethyl-3,4-dihydro-7-[2-methyl-6-(1H-1,2,4-triazol-5-yl)-3-pyridinyl]-, hydrochloride (1:?)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
CC-115 hydrochloride
CAS:CC-115 hydrochloride: potent DNA-PK/mTOR inhibitor; IC50s: 13 nM and 21 nM; blocks mTORC1/C2 pathways.Formula:C16H17ClN8OColor and Shape:SolidMolecular weight:372.82
