CAS 130014-35-6

2-[[(2-Ethylcyclohexyl)oxy]methyl]oxirane

Description:

2-[[(2-Ethylcyclohexyl)oxy]methyl]oxirane, identified by its CAS number 130014-35-6, is a chemical compound characterized by its epoxide functional group, which is a three-membered cyclic ether. This compound features a substituted oxirane ring, where the oxygen atom is part of a cyclic structure, contributing to its reactivity and potential applications in polymer chemistry and as a building block in organic synthesis. The presence of the 2-ethylcyclohexyl group enhances its hydrophobic properties, making it suitable for various formulations, including coatings and adhesives. Additionally, the ether linkage provides stability while allowing for potential reactivity under specific conditions, such as in ring-opening reactions. The compound's physical properties, such as boiling point, melting point, and solubility, would typically depend on its molecular structure and the presence of substituents. Overall, 2-[[(2-Ethylcyclohexyl)oxy]methyl]oxirane is notable for its unique structure and potential utility in various chemical applications.

Formula: C₁₁H₂₀O₂

InChI: InChI=1S/C11H20O2/c1-2-9-5-3-4-6-11(9)13-8-10-7-12-10/h9-11H,2-8H2,1H3

InChI key: InChIKey=HJNDMZXMHCYYHB-UHFFFAOYSA-N

SMILES: O(CC1CO1)C2C(CC)CCCC2

Synonyms:

• Oxirane, [[(2-ethylcyclohexyl)oxy]methyl]-
• 2-[[(2-Ethylcyclohexyl)oxy]methyl]oxirane
• Oxirane, 2-[[(2-ethylcyclohexyl)oxy]methyl]-

Oxirane, 2-[[(2-ethylcyclohexyl)oxy]methyl]-

CAS: 130014-35-6

Formula: C₁₁H₂₀O₂

Molecular weight: 184.2753

Ref: IN-DA000TX9