CymitQuimica logo

CAS 130016-98-7

:

N-[4-[4-Cyano-2-(2-furanylmethylene)-2,5-dihydro-5-oxo-3-furanyl]phenyl]-1-butanesulfonamide

Description:
N-[4-[4-Cyano-2-(2-furanylmethylene)-2,5-dihydro-5-oxo-3-furanyl]phenyl]-1-butanesulfonamide, with CAS number 130016-98-7, is a synthetic organic compound characterized by its complex molecular structure, which includes a sulfonamide functional group, a cyano group, and multiple furan rings. This compound exhibits potential biological activity, often investigated for its pharmacological properties. The presence of the furan moiety suggests possible interactions with biological targets, as furan derivatives are known for their diverse biological activities, including anti-inflammatory and antimicrobial effects. The sulfonamide group may contribute to its solubility and reactivity, making it a candidate for various chemical reactions. Additionally, the cyano group can enhance the compound's electronic properties, potentially influencing its reactivity and interaction with other molecules. Overall, this compound's unique structural features may provide insights into its potential applications in medicinal chemistry and drug development, although specific biological activities and mechanisms would require further empirical investigation.
Formula:C20H18N2O5S
InChI:InChI=1S/C20H18N2O5S/c1-2-3-11-28(24,25)22-15-8-6-14(7-9-15)19-17(13-21)20(23)27-18(19)12-16-5-4-10-26-16/h4-10,12,22H,2-3,11H2,1H3
InChI key:InChIKey=DESLCFKWTJEBGT-UHFFFAOYSA-N
SMILES:C(=C1C(=C(C#N)C(=O)O1)C2=CC=C(NS(CCCC)(=O)=O)C=C2)C3=CC=CO3
Synonyms:
  • 1-Butanesulfonamide, N-[4-[4-cyano-2-(2-furanylmethylene)-2,5-dihydro-5-oxo-3-furanyl]phenyl]-
  • N-[4-[4-Cyano-2-(2-furanylmethylene)-2,5-dihydro-5-oxo-3-furanyl]phenyl]-1-butanesulfonamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.