CAS 130019-48-6

5-(3-Benzyloxyphenyl)-1H-tetrazole

Description:

5-(3-Benzyloxyphenyl)-1H-tetrazole is an organic compound characterized by its tetrazole ring, which consists of four nitrogen atoms and one carbon atom, contributing to its unique chemical properties. The presence of the benzyloxyphenyl group enhances its aromatic character and may influence its solubility and reactivity. This compound is typically used in medicinal chemistry and material science due to its potential biological activities and ability to form coordination complexes. It may exhibit properties such as being a weak acid or base, depending on the functional groups present. The tetrazole moiety is known for its ability to participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. Additionally, compounds like this one can serve as precursors for the synthesis of more complex molecules or as intermediates in pharmaceutical development. Its specific applications and behavior in reactions can vary based on the surrounding chemical environment and the presence of other functional groups.

Formula: C₁₄H₁₂N₄O

InChI: InChI=1/C14H12N4O/c1-2-5-11(6-3-1)10-19-13-8-4-7-12(9-13)14-15-17-18-16-14/h1-9H,10H2,(H,15,16,17,18)

Synonyms:

• 5-[3-(benzyloxy)phenyl]-2H-tetrazole

2H-Tetrazole, 5-[4-(phenylmethoxy)phenyl]-

CAS: 130019-48-6

Formula: C₁₄H₁₂N₄O

Molecular weight: 252.2713

Ref: IN-DA000TX1