CAS 130047-15-3
:Benzoic acid, 5-amino-2-fluoro-, hydrochloride (1:1)
Description:
Benzoic acid, 5-amino-2-fluoro-, hydrochloride (1:1), with the CAS number 130047-15-3, is a chemical compound characterized by its structure, which includes a benzoic acid moiety substituted with an amino group and a fluorine atom. This compound typically appears as a white to off-white crystalline solid and is soluble in water, reflecting its ionic nature due to the presence of the hydrochloride salt. The amino group contributes to its basicity, while the carboxylic acid group provides acidic properties, allowing for potential interactions in various chemical environments. Its fluorine substitution can influence the compound's reactivity and biological activity, making it of interest in pharmaceutical and medicinal chemistry. The hydrochloride form enhances its stability and solubility, which is advantageous for formulation in drug development. Overall, this compound's unique functional groups and structural characteristics make it a subject of interest for further research and applications in various fields, including organic synthesis and drug design.
Formula:C7H6FNO2·ClH
InChI:InChI=1S/C7H6FNO2.ClH/c8-6-2-1-4(9)3-5(6)7(10)11;/h1-3H,9H2,(H,10,11);1H
InChI key:InChIKey=UUAQLLHDUVUFFC-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(F)C=CC(N)=C1.Cl
Synonyms:- 3-Amino-6-fluorobenzoic acid hydrochloride
- 5-Amino-2-fluorobenzoic acid hydrochloride
- Benzoic acid, 5-amino-2-fluoro-, hydrochloride
- Benzoic acid, 5-amino-2-fluoro-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.