CAS 130049-80-8
:3-(2-chloroethyl)-7-methoxy-2-methyl-6,7,8,9-tetrahydro-4H-pyrido[1,2-a]pyrimidin-4-one
Description:
3-(2-chloroethyl)-7-methoxy-2-methyl-6,7,8,9-tetrahydro-4H-pyrido[1,2-a]pyrimidin-4-one, with the CAS number 130049-80-8, is a chemical compound characterized by its complex bicyclic structure, which incorporates both pyridine and pyrimidine rings. This compound features a chloroethyl substituent, which may impart specific reactivity and biological activity, as well as a methoxy group that can influence its solubility and interaction with biological targets. The presence of multiple rings and substituents suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Its tetrahydro configuration indicates that it is a saturated derivative, which may enhance its stability and bioavailability. The compound's unique structural features could contribute to its pharmacological properties, making it a candidate for further research in drug development. However, detailed studies on its biological activity, toxicity, and mechanism of action would be necessary to fully understand its potential applications.
Formula:C12H17ClN2O2
InChI:InChI=1/C12H17ClN2O2/c1-8-10(5-6-13)12(16)15-7-9(17-2)3-4-11(15)14-8/h9H,3-7H2,1-2H3
SMILES:Cc1c(CCCl)c(=O)n2CC(CCc2n1)OC
Synonyms:- 3-(2-Chloroethyl)-6,7,8,9-tetrahydro-7-methoxy-2-methyl-4H-pyrido[1,2-a]pyrimidin-4-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-(2-Chloroethyl)-7-methoxy-2-methyl-6,7,8,9-tetrahydro-4H-pyrido[1,2-a]pyrimidin-4-one
CAS:Formula:C12H17ClN2O2Color and Shape:LiquidMolecular weight:256.7286
