CAS 130049-83-1
:3-[2-[4-(6-Fluoro-1,2-benzisoxazol-3-yl)-1-piperidinyl]ethyl]-6,7,8,9-tetrahydro-7-methoxy-2-methyl-4H-pyrido[1,2-a]pyrimidin-4-one
Description:
The chemical substance known as 3-[2-[4-(6-Fluoro-1,2-benzisoxazol-3-yl)-1-piperidinyl]ethyl]-6,7,8,9-tetrahydro-7-methoxy-2-methyl-4H-pyrido[1,2-a]pyrimidin-4-one, with the CAS number 130049-83-1, is a complex organic compound characterized by its multi-cyclic structure and the presence of various functional groups. This compound features a pyrido[1,2-a]pyrimidinone core, which is fused with a tetrahydro structure, indicating it has a saturated ring system. The presence of a methoxy group and a fluorinated benzisoxazole moiety suggests potential biological activity, possibly related to neuropharmacological effects, given the piperidine ring that is often associated with such properties. The fluorine atom may enhance the compound's lipophilicity and metabolic stability. Overall, this substance is of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its intricate structure and functionalization may contribute to its efficacy and specificity in therapeutic applications.
Formula:C24H29FN4O3
InChI:InChI=1S/C24H29FN4O3/c1-15-19(24(30)29-14-18(31-2)4-6-22(29)26-15)9-12-28-10-7-16(8-11-28)23-20-5-3-17(25)13-21(20)32-27-23/h3,5,13,16,18H,4,6-12,14H2,1-2H3
InChI key:InChIKey=DJOZJQFKYPYSCC-UHFFFAOYSA-N
SMILES:FC=1C=C2C(C(=NO2)C3CCN(CCC=4C(=O)N5C(=NC4C)CCC(OC)C5)CC3)=CC1
Synonyms:- 4H-Pyrido[1,2-a]pyrimidin-4-one, 3-[2-[4-(6-fluoro-1,2-benzisoxazol-3-yl)-1-piperidinyl]ethyl]-6,7,8,9-tetrahydro-7-methoxy-2-methyl-
- 3-[2-[4-(6-Fluoro-1,2-benzisoxazol-3-yl)-1-piperidinyl]ethyl]-6,7,8,9-tetrahydro-7-methoxy-2-methyl-4H-pyrido[1,2-a]pyrimidin-4-one
- 1,2-Benzisoxazole, 4H-pyrido[1,2-a]pyrimidin-4-one deriv.
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.