CAS 13005-52-2
:N-Methyl-N-(1-oxododecyl)glycine ethyl ester
Description:
N-Methyl-N-(1-oxododecyl)glycine ethyl ester, with the CAS number 13005-52-2, is an organic compound that belongs to the class of amino acid derivatives. This substance features a glycine backbone modified with a dodecyl chain, which contributes to its amphiphilic nature, making it soluble in both polar and non-polar solvents. The presence of the ethyl ester group enhances its lipophilicity, potentially influencing its behavior in biological systems and applications in surfactants or emulsifiers. The N-methyl substitution can affect the compound's steric properties and reactivity, possibly enhancing its stability compared to its non-methylated counterparts. This compound may exhibit surfactant properties, making it useful in formulations for detergents, personal care products, or pharmaceuticals. Additionally, its structure suggests potential applications in drug delivery systems or as a biochemical probe due to its ability to interact with various biological membranes. Overall, N-Methyl-N-(1-oxododecyl)glycine ethyl ester is characterized by its unique structural features that impart specific chemical and physical properties suitable for diverse applications.
Formula:C17H33NO3
InChI:InChI=1S/C17H33NO3/c1-4-6-7-8-9-10-11-12-13-14-16(19)18(3)15-17(20)21-5-2/h4-15H2,1-3H3
InChI key:InChIKey=SYMLPHXUMNTFCM-UHFFFAOYSA-N
SMILES:C(N(C(CCCCCCCCCCC)=O)C)C(OCC)=O
Synonyms:- Glycine, N-methyl-N-(1-oxododecyl)-, ethyl ester
- Sarcosine, N-lauroyl-, ethyl ester
- Ethyl N-dodecanoyl-N-methylglycinate
- N-Methyl-N-(1-oxododecyl)glycine ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
